C18H20AsNO6 — CID 174725050
(2-acetamido-4-hydroxyphenyl)-(2-phenylbutanoyloxy)arsinic acid (PubChem CID 174725050) has the molecular formula C18H20AsNO6 and a molecular weight of 421.28 g/mol. Its IUPAC name is (2-acetamido-4-hydroxyphenyl)-(2-phenylbutanoyloxy)arsinic acid.
| Compound Name | (2-acetamido-4-hydroxyphenyl)-(2-phenylbutanoyloxy)arsinic acid |
|---|---|
| PubChem CID | 174725050 |
| Molecular Formula | C18H20AsNO6 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (2-acetamido-4-hydroxyphenyl)-(2-phenylbutanoyloxy)arsinic acid |
| SMILES | CCC(C(=O)O[As](=O)(O)c1ccc(O)cc1NC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C18H20AsNO6/c1-3-15(13-7-5-4-6-8-13)18(23)26-19(24,25)16-10-9-14(22)11-17(16)20-12(2)21/h4-11,15,22H,3H2,1-2H3,(H,20,21)(H,24,25) |
| InChIKey | KYWCRYWFMXFOPZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|