C18H18AsNO6 — CID 174664736
[(2-acetamido-4-hydroxyphenyl)-methoxyarsoryl] (Z)-3-phenylprop-2-enoate (PubChem CID 174664736) has the molecular formula C18H18AsNO6 and a molecular weight of 419.27 g/mol. Its IUPAC name is [(2-acetamido-4-hydroxyphenyl)-methoxyarsoryl] (Z)-3-phenylprop-2-enoate.
| Compound Name | [(2-acetamido-4-hydroxyphenyl)-methoxyarsoryl] (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 174664736 |
| Molecular Formula | C18H18AsNO6 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | [(2-acetamido-4-hydroxyphenyl)-methoxyarsoryl] (Z)-3-phenylprop-2-enoate |
| SMILES | CO[As](=O)(OC(=O)/C=C\c1ccccc1)c1ccc(O)cc1NC(C)=O |
| InChI | InChI=1S/C18H18AsNO6/c1-13(21)20-17-12-15(22)9-10-16(17)19(24,25-2)26-18(23)11-8-14-6-4-3-5-7-14/h3-12,22H,1-2H3,(H,20,21)/b11-8- |
| InChIKey | WJWFNDQSKZZDPW-FLIBITNWSA-N |
| XLogP | 1.83 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|