C13H15AsNO8P — CID 174961146
(2-acetamido-4-hydroxyphenyl)-[(Z)-5-hydroxy-4-phosphorosopent-2-enoyl]oxyarsinic acid (PubChem CID 174961146) has the molecular formula C13H15AsNO8P and a molecular weight of 419.16 g/mol. Its IUPAC name is (2-acetamido-4-hydroxyphenyl)-[(Z)-5-hydroxy-4-phosphorosopent-2-enoyl]oxyarsinic acid.
| Compound Name | (2-acetamido-4-hydroxyphenyl)-[(Z)-5-hydroxy-4-phosphorosopent-2-enoyl]oxyarsinic acid |
|---|---|
| PubChem CID | 174961146 |
| Molecular Formula | C13H15AsNO8P |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | (2-acetamido-4-hydroxyphenyl)-[(Z)-5-hydroxy-4-phosphorosopent-2-enoyl]oxyarsinic acid |
| SMILES | CC(=O)Nc1cc(O)ccc1[As](=O)(O)OC(=O)/C=C\C(CO)P=O |
| InChI | InChI=1S/C13H15AsNO8P/c1-8(17)15-12-6-9(18)2-4-11(12)14(20,21)23-13(19)5-3-10(7-16)24-22/h2-6,10,16,18H,7H2,1H3,(H,15,17)(H,20,21)/b5-3- |
| InChIKey | YEDQTZGUSNVNLA-HYXAFXHYSA-N |
| XLogP | -0.33 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|