C13H19AsNO9P — CID 174670621
(2-acetamidophenyl)-hydroperoxyarsinic acid;5-hydroxy-2-phosphorosopentanoic acid (PubChem CID 174670621) has the molecular formula C13H19AsNO9P and a molecular weight of 439.19 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;5-hydroxy-2-phosphorosopentanoic acid.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;5-hydroxy-2-phosphorosopentanoic acid |
|---|---|
| PubChem CID | 174670621 |
| Molecular Formula | C13H19AsNO9P |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;5-hydroxy-2-phosphorosopentanoic acid |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.O=PC(CCCO)C(=O)O |
| InChI | InChI=1S/C8H10AsNO5.C5H9O4P/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;6-3-1-2-4(10-9)5(7)8/h2-5,14H,1H3,(H,10,11)(H,12,13);4,6H,1-3H2,(H,7,8) |
| InChIKey | DKMUWQDKMSCZAK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|