C12H18AsNO8 — CID 174902102
(2-acetamidophenyl)-hydroperoxyarsinic acid;3-methoxypropanoic acid (PubChem CID 174902102) has the molecular formula C12H18AsNO8 and a molecular weight of 379.20 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;3-methoxypropanoic acid.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;3-methoxypropanoic acid |
|---|---|
| PubChem CID | 174902102 |
| Molecular Formula | C12H18AsNO8 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;3-methoxypropanoic acid |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.COCCC(=O)O |
| InChI | InChI=1S/C8H10AsNO5.C4H8O3/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;1-7-3-2-4(5)6/h2-5,14H,1H3,(H,10,11)(H,12,13);2-3H2,1H3,(H,5,6) |
| InChIKey | MSGJRZFKIJTEBE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|