C24H27AsN2O8 — CID 174704193
(2-acetamidophenyl)-hydroperoxyarsinic acid;N-(3,4-dimethoxyphenyl)-N-methylbenzamide (PubChem CID 174704193) has the molecular formula C24H27AsN2O8 and a molecular weight of 546.41 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;N-(3,4-dimethoxyphenyl)-N-methylbenzamide.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;N-(3,4-dimethoxyphenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 174704193 |
| Molecular Formula | C24H27AsN2O8 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;N-(3,4-dimethoxyphenyl)-N-methylbenzamide |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.COc1ccc(N(C)C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H17NO3.C8H10AsNO5/c1-17(16(18)12-7-5-4-6-8-12)13-9-10-14(19-2)15(11-13)20-3;1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14/h4-11H,1-3H3;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | KJPYAOFEZZURAT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|