C14H16AsBClNO7 — CID 174686253
(2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid (PubChem CID 174686253) has the molecular formula C14H16AsBClNO7 and a molecular weight of 431.47 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid |
|---|---|
| PubChem CID | 174686253 |
| Molecular Formula | C14H16AsBClNO7 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.OB(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H10AsNO5.C6H6BClO2/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;8-6-3-1-2-5(4-6)7(9)10/h2-5,14H,1H3,(H,10,11)(H,12,13);1-4,9-10H |
| InChIKey | FSZSTKCAUXPXHE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|