C14H18AsClN2O8S — CID 174654844
(2-acetamidophenyl)-hydroperoxyarsinic acid;2-methylpyridine-3-sulfonic acid;hydrochloride (PubChem CID 174654844) has the molecular formula C14H18AsClN2O8S and a molecular weight of 484.75 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;2-methylpyridine-3-sulfonic acid;hydrochloride.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-methylpyridine-3-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174654844 |
| Molecular Formula | C14H18AsClN2O8S |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-methylpyridine-3-sulfonic acid;hydrochloride |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.Cc1ncccc1S(=O)(=O)O.Cl |
| InChI | InChI=1S/C8H10AsNO5.C6H7NO3S.ClH/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;1-5-6(11(8,9)10)3-2-4-7-5;/h2-5,14H,1H3,(H,10,11)(H,12,13);2-4H,1H3,(H,8,9,10);1H |
| InChIKey | HZGZOBFVKUAJDF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|