C13H13AsBrN3O7 — CID 174425311
(2-acetamidophenyl)-hydroperoxyarsinic acid;2-bromo-5-nitropyridine (PubChem CID 174425311) has the molecular formula C13H13AsBrN3O7 and a molecular weight of 478.09 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;2-bromo-5-nitropyridine.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-bromo-5-nitropyridine |
|---|---|
| PubChem CID | 174425311 |
| Molecular Formula | C13H13AsBrN3O7 |
| Molecular Weight | 478.09 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-bromo-5-nitropyridine |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.O=[N+]([O-])c1ccc(Br)nc1 |
| InChI | InChI=1S/C8H10AsNO5.C5H3BrN2O2/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;6-5-2-1-4(3-7-5)8(9)10/h2-5,14H,1H3,(H,10,11)(H,12,13);1-3H |
| InChIKey | DVQOJSXWZFPXDH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.09 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|