C16H20AsN3O7 — CID 174249909
(3-acetamido-2-hydroxyphenyl)arsonic acid;N,N-dimethyl-4-nitroaniline (PubChem CID 174249909) has the molecular formula C16H20AsN3O7 and a molecular weight of 441.27 g/mol. Its IUPAC name is (3-acetamido-2-hydroxyphenyl)arsonic acid;N,N-dimethyl-4-nitroaniline.
| Compound Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;N,N-dimethyl-4-nitroaniline |
|---|---|
| PubChem CID | 174249909 |
| Molecular Formula | C16H20AsN3O7 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | (3-acetamido-2-hydroxyphenyl)arsonic acid;N,N-dimethyl-4-nitroaniline |
| SMILES | CC(=O)Nc1cccc([As](=O)(O)O)c1O.CN(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H10AsNO5.C8H10N2O2/c1-5(11)10-7-4-2-3-6(8(7)12)9(13,14)15;1-9(2)7-3-5-8(6-4-7)10(11)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);3-6H,1-2H3 |
| InChIKey | JWQIWXFVTHESRA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 153.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|