C21H19AsN2O8 — CID 174916439
(2-acetamidophenyl)-hydroperoxyarsinic acid;(4-nitrophenyl)-phenylmethanone (PubChem CID 174916439) has the molecular formula C21H19AsN2O8 and a molecular weight of 502.31 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;(4-nitrophenyl)-phenylmethanone.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(4-nitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 174916439 |
| Molecular Formula | C21H19AsN2O8 |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(4-nitrophenyl)-phenylmethanone |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C8H10AsNO5/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14/h1-9H;2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | ALQKXGASAFCQQB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 156.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|