C20H30AsBClNO9 — CID 174674471
(2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid;2,3-dimethylbutane-2,3-diol (PubChem CID 174674471) has the molecular formula C20H30AsBClNO9 and a molecular weight of 549.65 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid;2,3-dimethylbutane-2,3-diol.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid;2,3-dimethylbutane-2,3-diol |
|---|---|
| PubChem CID | 174674471 |
| Molecular Formula | C20H30AsBClNO9 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;(3-chlorophenyl)boronic acid;2,3-dimethylbutane-2,3-diol |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.CC(C)(O)C(C)(C)O.OB(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H10AsNO5.C6H6BClO2.C6H14O2/c1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14;8-6-3-1-2-5(4-6)7(9)10;1-5(2,7)6(3,4)8/h2-5,14H,1H3,(H,10,11)(H,12,13);1-4,9-10H;7-8H,1-4H3 |
| InChIKey | VVTAYRKLMRFRMD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|