C19H22AsNO9 — CID 174952648
(2-acetamidophenyl)-hydroperoxyarsinic acid;2-(2-phenylethyl)propanedioic acid (PubChem CID 174952648) has the molecular formula C19H22AsNO9 and a molecular weight of 483.31 g/mol. Its IUPAC name is (2-acetamidophenyl)-hydroperoxyarsinic acid;2-(2-phenylethyl)propanedioic acid.
| Compound Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-(2-phenylethyl)propanedioic acid |
|---|---|
| PubChem CID | 174952648 |
| Molecular Formula | C19H22AsNO9 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (2-acetamidophenyl)-hydroperoxyarsinic acid;2-(2-phenylethyl)propanedioic acid |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(O)OO.O=C(O)C(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H12O4.C8H10AsNO5/c12-10(13)9(11(14)15)7-6-8-4-2-1-3-5-8;1-6(11)10-8-5-3-2-4-7(8)9(12,13)15-14/h1-5,9H,6-7H2,(H,12,13)(H,14,15);2-5,14H,1H3,(H,10,11)(H,12,13) |
| InChIKey | TUGSRXGZNOHZGI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|