C16H18AsNO5 — CID 175323372
N-[2-[hydroperoxy(2-phenylethoxy)arsoryl]phenyl]acetamide (PubChem CID 175323372) has the molecular formula C16H18AsNO5 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-[2-[hydroperoxy(2-phenylethoxy)arsoryl]phenyl]acetamide.
| Compound Name | N-[2-[hydroperoxy(2-phenylethoxy)arsoryl]phenyl]acetamide |
|---|---|
| PubChem CID | 175323372 |
| Molecular Formula | C16H18AsNO5 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[2-[hydroperoxy(2-phenylethoxy)arsoryl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1[As](=O)(OO)OCCc1ccccc1 |
| InChI | InChI=1S/C16H18AsNO5/c1-13(19)18-16-10-6-5-9-15(16)17(20,23-21)22-12-11-14-7-3-2-4-8-14/h2-10,21H,11-12H2,1H3,(H,18,19) |
| InChIKey | CZLZUNMVYOULJE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|