C17H24AsNO6 — CID 174387826
(2-acetamido-4-hydroxyphenyl)-non-8-enoyloxyarsinic acid (PubChem CID 174387826) has the molecular formula C17H24AsNO6 and a molecular weight of 413.30 g/mol. Its IUPAC name is (2-acetamido-4-hydroxyphenyl)-non-8-enoyloxyarsinic acid.
| Compound Name | (2-acetamido-4-hydroxyphenyl)-non-8-enoyloxyarsinic acid |
|---|---|
| PubChem CID | 174387826 |
| Molecular Formula | C17H24AsNO6 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (2-acetamido-4-hydroxyphenyl)-non-8-enoyloxyarsinic acid |
| SMILES | C=CCCCCCCC(=O)O[As](=O)(O)c1ccc(O)cc1NC(C)=O |
| InChI | InChI=1S/C17H24AsNO6/c1-3-4-5-6-7-8-9-17(22)25-18(23,24)15-11-10-14(21)12-16(15)19-13(2)20/h3,10-12,21H,1,4-9H2,2H3,(H,19,20)(H,23,24) |
| InChIKey | BHYOICJBHNDFCX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|