C24H24AsNO7 — CID 174658194
(2-acetamido-4-hydroxyphenyl)-[3-(4-phenylmethoxyphenyl)propanoyloxy]arsinic acid (PubChem CID 174658194) has the molecular formula C24H24AsNO7 and a molecular weight of 513.38 g/mol. Its IUPAC name is (2-acetamido-4-hydroxyphenyl)-[3-(4-phenylmethoxyphenyl)propanoyloxy]arsinic acid.
| Compound Name | (2-acetamido-4-hydroxyphenyl)-[3-(4-phenylmethoxyphenyl)propanoyloxy]arsinic acid |
|---|---|
| PubChem CID | 174658194 |
| Molecular Formula | C24H24AsNO7 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (2-acetamido-4-hydroxyphenyl)-[3-(4-phenylmethoxyphenyl)propanoyloxy]arsinic acid |
| SMILES | CC(=O)Nc1cc(O)ccc1[As](=O)(O)OC(=O)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24AsNO7/c1-17(27)26-23-15-20(28)10-13-22(23)25(30,31)33-24(29)14-9-18-7-11-21(12-8-18)32-16-19-5-3-2-4-6-19/h2-8,10-13,15,28H,9,14,16H2,1H3,(H,26,27)(H,30,31) |
| InChIKey | DRIANRYKZFNKCO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|