C10H8N2O3 — CID 131596537
N-(2,3-dioxo-1H-indol-7-yl)acetamide (PubChem CID 131596537) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(2,3-dioxo-1H-indol-7-yl)acetamide.
| Compound Name | N-(2,3-dioxo-1H-indol-7-yl)acetamide |
|---|---|
| PubChem CID | 131596537 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N-(2,3-dioxo-1H-indol-7-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H8N2O3/c1-5(13)11-7-4-2-3-6-8(7)12-10(15)9(6)14/h2-4H,1H3,(H,11,13)(H,12,14,15) |
| InChIKey | BVQLNYOGGJMKGJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|