C14H14N2O3 — CID 170489428
N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]acetamide (PubChem CID 170489428) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]acetamide.
| Compound Name | N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489428 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1cccc2c1NC(=O)C2=O |
| InChI | InChI=1S/C14H14N2O3/c1-9(17)15-8-3-2-5-10-6-4-7-11-12(10)16-14(19)13(11)18/h2,4-7H,3,8H2,1H3,(H,15,17)(H,16,18,19) |
| InChIKey | PERCUYWBGWMHBR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|