C20H18N2O4 — CID 170494796
benzyl N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]carbamate (PubChem CID 170494796) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is benzyl N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494796 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | benzyl N-[4-(2,3-dioxo-1H-indol-7-yl)but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cccc2c1NC(=O)C2=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H18N2O4/c23-18-16-11-6-10-15(17(16)22-19(18)24)9-4-5-12-21-20(25)26-13-14-7-2-1-3-8-14/h1-4,6-11H,5,12-13H2,(H,21,25)(H,22,23,24) |
| InChIKey | FMGQSNJVQFBKAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|