C19H19N3O2 — CID 170493997
benzyl N-[4-(3-amino-2-cyanophenyl)but-3-enyl]carbamate (PubChem CID 170493997) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl N-[4-(3-amino-2-cyanophenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(3-amino-2-cyanophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493997 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | benzyl N-[4-(3-amino-2-cyanophenyl)but-3-enyl]carbamate |
| SMILES | N#Cc1c(N)cccc1C=CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c20-13-17-16(10-6-11-18(17)21)9-4-5-12-22-19(23)24-14-15-7-2-1-3-8-15/h1-4,6-11H,5,12,14,21H2,(H,22,23) |
| InChIKey | VOEQIHLTRXDVHQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|