C19H18N2O6 — CID 171856702
benzyl N-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856702) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is benzyl N-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856702 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | benzyl N-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc2c1NC(=O)C2=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O6/c22-14(9-20-19(26)27-10-11-5-2-1-3-6-11)16(23)12-7-4-8-13-15(12)21-18(25)17(13)24/h1-8,14,16,22-23H,9-10H2,(H,20,26)(H,21,24,25) |
| InChIKey | XOWXWAUZZCOJPM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|