C12H12N2O5 — CID 171899954
4-(2,3-dioxo-1H-indol-7-yl)-3,4-dihydroxybutanamide (PubChem CID 171899954) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4-(2,3-dioxo-1H-indol-7-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(2,3-dioxo-1H-indol-7-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899954 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-(2,3-dioxo-1H-indol-7-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cccc2c1NC(=O)C2=O |
| InChI | InChI=1S/C12H12N2O5/c13-8(16)4-7(15)10(17)5-2-1-3-6-9(5)14-12(19)11(6)18/h1-3,7,10,15,17H,4H2,(H2,13,16)(H,14,18,19) |
| InChIKey | PTPJXGXRGDGHMB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|