C13H13NO5S — CID 170822714
S-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822714) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is S-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822714 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | S-[3-(2,3-dioxo-1H-indol-7-yl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccc2c1NC(=O)C2=O |
| InChI | InChI=1S/C13H13NO5S/c1-6(15)20-5-9(16)11(17)7-3-2-4-8-10(7)14-13(19)12(8)18/h2-4,9,11,16-17H,5H2,1H3,(H,14,18,19) |
| InChIKey | XYPLBLQXJSEAFA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|