C13H15NO4S — CID 170822166
S-[2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-7-yl)propyl] ethanethioate (PubChem CID 170822166) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-7-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-7-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822166 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | S-[2,3-dihydroxy-3-(2-oxo-1,3-dihydroindol-7-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccc2c1NC(=O)C2 |
| InChI | InChI=1S/C13H15NO4S/c1-7(15)19-6-10(16)13(18)9-4-2-3-8-5-11(17)14-12(8)9/h2-4,10,13,16,18H,5-6H2,1H3,(H,14,17) |
| InChIKey | MHUBPMYLJVZAEZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|