C14H15NO3 — CID 117364721
3-cyclopropyl-3-(2-oxo-1,3-dihydroindol-7-yl)propanoic acid (PubChem CID 117364721) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-cyclopropyl-3-(2-oxo-1,3-dihydroindol-7-yl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(2-oxo-1,3-dihydroindol-7-yl)propanoic acid |
|---|---|
| PubChem CID | 117364721 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-cyclopropyl-3-(2-oxo-1,3-dihydroindol-7-yl)propanoic acid |
| SMILES | O=C(O)CC(c1cccc2c1NC(=O)C2)C1CC1 |
| InChI | InChI=1S/C14H15NO3/c16-12-6-9-2-1-3-10(14(9)15-12)11(7-13(17)18)8-4-5-8/h1-3,8,11H,4-7H2,(H,15,16)(H,17,18) |
| InChIKey | PYAISQNIICWZBW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |