C14H16F2O2 — CID 117388777
3-cyclopropyl-3-[2-(1,1-difluoroethyl)phenyl]propanoic acid (PubChem CID 117388777) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-cyclopropyl-3-[2-(1,1-difluoroethyl)phenyl]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[2-(1,1-difluoroethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117388777 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-cyclopropyl-3-[2-(1,1-difluoroethyl)phenyl]propanoic acid |
| SMILES | CC(F)(F)c1ccccc1C(CC(=O)O)C1CC1 |
| InChI | InChI=1S/C14H16F2O2/c1-14(15,16)12-5-3-2-4-10(12)11(8-13(17)18)9-6-7-9/h2-5,9,11H,6-8H2,1H3,(H,17,18) |
| InChIKey | AZCIDCRLDGECMU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |