C13H13F3O3 — CID 117437908
3-cyclopropyl-3-[2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117437908) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-cyclopropyl-3-[2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117437908 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-cyclopropyl-3-[2-hydroxy-5-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CC(c1cc(C(F)(F)F)ccc1O)C1CC1 |
| InChI | InChI=1S/C13H13F3O3/c14-13(15,16)8-3-4-11(17)10(5-8)9(6-12(18)19)7-1-2-7/h3-5,7,9,17H,1-2,6H2,(H,18,19) |
| InChIKey | GNQYIMRLZKZQNW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |