C14H18O5 — CID 117419605
3-cyclopropyl-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoic acid (PubChem CID 117419605) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-cyclopropyl-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117419605 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-cyclopropyl-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(O)c(C(CC(=O)O)C2CC2)cc1OC |
| InChI | InChI=1S/C14H18O5/c1-18-12-5-10(11(15)7-13(12)19-2)9(6-14(16)17)8-3-4-8/h5,7-9,15H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | HRPNZLNVDRJZDT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |