C15H18O6 — CID 117474720
5-(2-carboxy-1-cyclopropylethyl)-2,4-dimethoxybenzoic acid (PubChem CID 117474720) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-(2-carboxy-1-cyclopropylethyl)-2,4-dimethoxybenzoic acid.
| Compound Name | 5-(2-carboxy-1-cyclopropylethyl)-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 117474720 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-(2-carboxy-1-cyclopropylethyl)-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(C(CC(=O)O)C2CC2)cc1C(=O)O |
| InChI | InChI=1S/C15H18O6/c1-20-12-7-13(21-2)11(15(18)19)5-10(12)9(6-14(16)17)8-3-4-8/h5,7-9H,3-4,6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | AQEJLWQHCYRQDJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |