C8H9N3OS — CID 1204329
N-(1,3-dihydro-2,1,3-benzothiadiazol-4-yl)acetamide (PubChem CID 1204329) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(1,3-dihydro-2,1,3-benzothiadiazol-4-yl)acetamide.
| Compound Name | N-(1,3-dihydro-2,1,3-benzothiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 1204329 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-(1,3-dihydro-2,1,3-benzothiadiazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2c1NSN2 |
| InChI | InChI=1S/C8H9N3OS/c1-5(12)9-6-3-2-4-7-8(6)11-13-10-7/h2-4,10-11H,1H3,(H,9,12) |
| InChIKey | RIUYDBDVRQKBTN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|