C23H28N4O — CID 145079203
N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-5-yl]acetamide (PubChem CID 145079203) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-5-yl]acetamide.
| Compound Name | N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-5-yl]acetamide |
|---|---|
| PubChem CID | 145079203 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-5-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1N/C(=N\Cc1cccc(C)c1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C23H28N4O/c1-16-8-6-9-18(14-16)15-24-22-23(12-4-3-5-13-23)27-20-11-7-10-19(21(20)26-22)25-17(2)28/h6-11,14,27H,3-5,12-13,15H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | NLFOAGFDKGYUBM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|