C22H27N3O — CID 145079251
7-methoxy-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 145079251) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 7-methoxy-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | 7-methoxy-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 145079251 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 7-methoxy-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | COc1ccc2c(c1)N/C(=N\Cc1cccc(C)c1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C22H27N3O/c1-16-7-6-8-17(13-16)15-23-21-22(11-4-3-5-12-22)25-19-10-9-18(26-2)14-20(19)24-21/h6-10,13-14,25H,3-5,11-12,15H2,1-2H3,(H,23,24) |
| InChIKey | LOIDKGRBNFDVGT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|