C22H26N4O2 — CID 145079335
N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6-yl]acetamide (PubChem CID 145079335) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6-yl]acetamide.
| Compound Name | N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6-yl]acetamide |
|---|---|
| PubChem CID | 145079335 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-[3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)N/C(=N\Cc1cccc(C)c1)C1(CCOCC1)N2 |
| InChI | InChI=1S/C22H26N4O2/c1-15-4-3-5-17(12-15)14-23-21-22(8-10-28-11-9-22)26-19-7-6-18(24-16(2)27)13-20(19)25-21/h3-7,12-13,26H,8-11,14H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | QCQYYUDHHDMECR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|