C23H26ClN5O3 — CID 137105329
N-[8-acetamido-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5-yl]acetamide (PubChem CID 137105329) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is N-[8-acetamido-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5-yl]acetamide.
| Compound Name | N-[8-acetamido-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5-yl]acetamide |
|---|---|
| PubChem CID | 137105329 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[8-acetamido-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(C)=O)c2c1N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)N2 |
| InChI | InChI=1S/C23H26ClN5O3/c1-14(30)26-18-6-7-19(27-15(2)31)21-20(18)28-22(23(29-21)8-10-32-11-9-23)25-13-16-4-3-5-17(24)12-16/h3-7,12,29H,8-11,13H2,1-2H3,(H,25,28)(H,26,30)(H,27,31) |
| InChIKey | QQJNRDUTRLSOLJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|