C22H24ClN3O2 — CID 148774314
2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-oxane]-8-carboxamide (PubChem CID 148774314) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-oxane]-8-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-oxane]-8-carboxamide |
|---|---|
| PubChem CID | 148774314 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-oxane]-8-carboxamide |
| SMILES | CNC(=O)c1cccc2c1N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)C2 |
| InChI | InChI=1S/C22H24ClN3O2/c1-24-20(27)18-7-3-5-16-13-22(8-10-28-11-9-22)21(26-19(16)18)25-14-15-4-2-6-17(23)12-15/h2-7,12H,8-11,13-14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | OJAOIRMTHBLMKI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|