C21H20ClN3O — CID 147162987
N-[(3-chlorophenyl)methyl]-7-isocyanospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 147162987) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-isocyanospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-isocyanospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 147162987 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-isocyanospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | [C-]#[N+]c1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)C2 |
| InChI | InChI=1S/C21H20ClN3O/c1-23-18-6-5-16-13-21(7-9-26-10-8-21)20(25-19(16)12-18)24-14-15-3-2-4-17(22)11-15/h2-6,11-12H,7-10,13-14H2,(H,24,25) |
| InChIKey | BWEYWOJETIKAKU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|