C21H23ClN2OS — CID 159920209
N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine (PubChem CID 159920209) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 159920209 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
| SMILES | COc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCSCC1)C2 |
| InChI | InChI=1S/C21H23ClN2OS/c1-25-18-6-5-16-13-21(7-9-26-10-8-21)20(24-19(16)12-18)23-14-15-3-2-4-17(22)11-15/h2-6,11-12H,7-10,13-14H2,1H3,(H,23,24) |
| InChIKey | NYHLAGJYYHSRIA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|