C20H20ClFN2O — CID 148501909
N-[(3-chlorophenyl)methyl]-7-fluorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 148501909) has the molecular formula C20H20ClFN2O and a molecular weight of 358.84 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-fluorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-fluorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 148501909 |
| Molecular Formula | C20H20ClFN2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-fluorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | Fc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)C2 |
| InChI | InChI=1S/C20H20ClFN2O/c21-16-3-1-2-14(10-16)13-23-19-20(6-8-25-9-7-20)12-15-4-5-17(22)11-18(15)24-19/h1-5,10-11H,6-9,12-13H2,(H,23,24) |
| InChIKey | MKUUKGQXXSYCFF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|