C22H26ClN3O — CID 147013778
2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-oxane]-7-amine (PubChem CID 147013778) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-oxane]-7-amine.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-oxane]-7-amine |
|---|---|
| PubChem CID | 147013778 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-oxane]-7-amine |
| SMILES | CN(C)c1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)C2 |
| InChI | InChI=1S/C22H26ClN3O/c1-26(2)19-7-6-17-14-22(8-10-27-11-9-22)21(25-20(17)13-19)24-15-16-4-3-5-18(23)12-16/h3-7,12-13H,8-11,14-15H2,1-2H3,(H,24,25) |
| InChIKey | AUJODNINZSMSRP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|