C27H33ClN4O2 — CID 158189843
2-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-6,7-dicarboxamide (PubChem CID 158189843) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-6,7-dicarboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-6,7-dicarboxamide |
|---|---|
| PubChem CID | 158189843 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-6,7-dicarboxamide |
| SMILES | CN(C)C(=O)c1cc2c(cc1C(=O)N(C)C)N/C(=N\Cc1cccc(Cl)c1)C1(CCCCC1)C2 |
| InChI | InChI=1S/C27H33ClN4O2/c1-31(2)24(33)21-14-19-16-27(11-6-5-7-12-27)26(29-17-18-9-8-10-20(28)13-18)30-23(19)15-22(21)25(34)32(3)4/h8-10,13-15H,5-7,11-12,16-17H2,1-4H3,(H,29,30) |
| InChIKey | FZPMQLANSYLGJA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|