C22H24Cl2N2 — CID 148904092
6,7-dichloro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine (PubChem CID 148904092) has the molecular formula C22H24Cl2N2 and a molecular weight of 387.35 g/mol. Its IUPAC name is 6,7-dichloro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine.
| Compound Name | 6,7-dichloro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 148904092 |
| Molecular Formula | C22H24Cl2N2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 6,7-dichloro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
| SMILES | Cc1cccc(C/N=C2\Nc3cc(Cl)c(Cl)cc3CC23CCCCC3)c1 |
| InChI | InChI=1S/C22H24Cl2N2/c1-15-6-5-7-16(10-15)14-25-21-22(8-3-2-4-9-22)13-17-11-18(23)19(24)12-20(17)26-21/h5-7,10-12H,2-4,8-9,13-14H2,1H3,(H,25,26) |
| InChIKey | PHIXNHVJFMDHOD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|