C23H26ClN3O — CID 149117692
2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-5-carboxamide (PubChem CID 149117692) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-5-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-5-carboxamide |
|---|---|
| PubChem CID | 149117692 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,1'-cyclohexane]-5-carboxamide |
| SMILES | CNC(=O)c1cccc2c1CC1(CCCCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C23H26ClN3O/c1-25-21(28)18-9-6-10-20-19(18)14-23(11-3-2-4-12-23)22(27-20)26-15-16-7-5-8-17(24)13-16/h5-10,13H,2-4,11-12,14-15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | QYWYEEAJNCOPMC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|