C22H24ClN3OS — CID 147750690
2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide (PubChem CID 147750690) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide |
|---|---|
| PubChem CID | 147750690 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N-methylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)CC1(CCSCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H24ClN3OS/c1-24-20(27)16-5-6-19-17(12-16)13-22(7-9-28-10-8-22)21(26-19)25-14-15-3-2-4-18(23)11-15/h2-6,11-12H,7-10,13-14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | HCDHPEUAOSLVNF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|