C22H25ClN2O2S — CID 152934820
N-[(3-chlorophenyl)methyl]-5,8-dimethoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine (PubChem CID 152934820) has the molecular formula C22H25ClN2O2S and a molecular weight of 416.97 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-5,8-dimethoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-5,8-dimethoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 152934820 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-5,8-dimethoxyspiro[1,4-dihydroquinoline-3,4'-thiane]-2-imine |
| SMILES | COc1ccc(OC)c2c1CC1(CCSCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H25ClN2O2S/c1-26-18-6-7-19(27-2)20-17(18)13-22(8-10-28-11-9-22)21(25-20)24-14-15-4-3-5-16(23)12-15/h3-7,12H,8-11,13-14H2,1-2H3,(H,24,25) |
| InChIKey | ULQWXUHBFCIPNT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|