C21H18ClN5S — CID 137046042
3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-thiane]-6,7-dicarbonitrile (PubChem CID 137046042) has the molecular formula C21H18ClN5S and a molecular weight of 407.93 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-thiane]-6,7-dicarbonitrile.
| Compound Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-thiane]-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 137046042 |
| Molecular Formula | C21H18ClN5S |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-thiane]-6,7-dicarbonitrile |
| SMILES | N#Cc1cc2c(cc1C#N)NC1(CCSCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C21H18ClN5S/c22-17-3-1-2-14(8-17)13-25-20-21(4-6-28-7-5-21)27-19-10-16(12-24)15(11-23)9-18(19)26-20/h1-3,8-10,27H,4-7,13H2,(H,25,26) |
| InChIKey | RFSDWMPOHOMOGX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|