C19H19Br2ClN4 — CID 137105442
6,7-dibromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine (PubChem CID 137105442) has the molecular formula C19H19Br2ClN4 and a molecular weight of 498.65 g/mol. Its IUPAC name is 6,7-dibromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine.
| Compound Name | 6,7-dibromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 137105442 |
| Molecular Formula | C19H19Br2ClN4 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | 6,7-dibromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
| SMILES | Clc1cccc(C/N=C2\Nc3cc(Br)c(Br)cc3NC23CCNCC3)c1 |
| InChI | InChI=1S/C19H19Br2ClN4/c20-14-9-16-17(10-15(14)21)26-19(4-6-23-7-5-19)18(25-16)24-11-12-2-1-3-13(22)8-12/h1-3,8-10,23,26H,4-7,11H2,(H,24,25) |
| InChIKey | ZFRGXGMFARDNTC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|