C20H21BrClN3 — CID 137105166
7-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 137105166) has the molecular formula C20H21BrClN3 and a molecular weight of 418.77 g/mol. Its IUPAC name is 7-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | 7-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 137105166 |
| Molecular Formula | C20H21BrClN3 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 7-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | Clc1cccc(C/N=C2\Nc3cc(Br)ccc3NC23CCCCC3)c1 |
| InChI | InChI=1S/C20H21BrClN3/c21-15-7-8-17-18(12-15)24-19(20(25-17)9-2-1-3-10-20)23-13-14-5-4-6-16(22)11-14/h4-8,11-12,25H,1-3,9-10,13H2,(H,23,24) |
| InChIKey | WOGRFXYCLCYCFR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|