C20H20ClN5 — CID 137104901
3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-carbonitrile (PubChem CID 137104901) has the molecular formula C20H20ClN5 and a molecular weight of 365.87 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-carbonitrile.
| Compound Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-carbonitrile |
|---|---|
| PubChem CID | 137104901 |
| Molecular Formula | C20H20ClN5 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCNCC1)N2 |
| InChI | InChI=1S/C20H20ClN5/c21-16-3-1-2-15(10-16)13-24-19-20(6-8-23-9-7-20)26-17-5-4-14(12-22)11-18(17)25-19/h1-5,10-11,23,26H,6-9,13H2,(H,24,25) |
| InChIKey | JJNXHOWJSIGYIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|