C22H27ClN4O — CID 137100510
N-[(3-chlorophenyl)methyl]-6-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine (PubChem CID 137100510) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-6-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-6-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 137100510 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-6-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
| SMILES | COCCc1ccc2c(c1)NC1(CCNCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H27ClN4O/c1-28-12-7-16-5-6-19-20(14-16)27-22(8-10-24-11-9-22)21(26-19)25-15-17-3-2-4-18(23)13-17/h2-6,13-14,24,27H,7-12,15H2,1H3,(H,25,26) |
| InChIKey | PUFHTXVQGANDRA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|