C22H25ClN4 — CID 137122971
N-[(3-chlorophenyl)methyl]-7-prop-1-enylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine (PubChem CID 137122971) has the molecular formula C22H25ClN4 and a molecular weight of 380.92 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-prop-1-enylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-prop-1-enylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 137122971 |
| Molecular Formula | C22H25ClN4 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-prop-1-enylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
| SMILES | CC=Cc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCNCC1)N2 |
| InChI | InChI=1S/C22H25ClN4/c1-2-4-16-7-8-19-20(14-16)26-21(22(27-19)9-11-24-12-10-22)25-15-17-5-3-6-18(23)13-17/h2-8,13-14,24,27H,9-12,15H2,1H3,(H,25,26) |
| InChIKey | LRBPHYINDAXIKS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|